C26H26F4IN3O2 — CID 89347675
1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-1-hydroxybutan-2-yl]urea (PubChem CID 89347675) has the molecular formula C26H26F4IN3O2 and a molecular weight of 615.41 g/mol. Its IUPAC name is 1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-1-hydroxybutan-2-yl]urea.
| Compound Name | 1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-1-hydroxybutan-2-yl]urea |
|---|---|
| PubChem CID | 89347675 |
| Molecular Formula | C26H26F4IN3O2 |
| Molecular Weight | 615.41 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | 1-[(1S)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-1-[5-(iodomethyl)-2-pyridinyl]-2-phenylethyl]-3-[(2R)-1-hydroxybutan-2-yl]urea |
| SMILES | CC[C@H](CO)NC(=O)N[C@@](Cc1ccccc1)(c1cc(F)cc(C(F)(F)F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C26H26F4IN3O2/c1-2-22(16-35)33-24(36)34-25(13-17-6-4-3-5-7-17,23-9-8-18(14-31)15-32-23)19-10-20(26(28,29)30)12-21(27)11-19/h3-12,15,22,35H,2,13-14,16H2,1H3,(H2,33,34,36)/t22-,25+/m1/s1 |
| InChIKey | LMZRVOSOKMTLNK-RDGATRHJSA-N |
| XLogP | 5.73 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|