C26H27F3IN3O — CID 89347680
1-[(1R)-1-[5-(iodomethyl)-2-pyridinyl]-1-[4-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-propan-2-ylurea (PubChem CID 89347680) has the molecular formula C26H27F3IN3O and a molecular weight of 581.42 g/mol. Its IUPAC name is 1-[(1R)-1-[5-(iodomethyl)-2-pyridinyl]-1-[4-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-propan-2-ylurea.
| Compound Name | 1-[(1R)-1-[5-(iodomethyl)-2-pyridinyl]-1-[4-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 89347680 |
| Molecular Formula | C26H27F3IN3O |
| Molecular Weight | 581.42 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | 1-[(1R)-1-[5-(iodomethyl)-2-pyridinyl]-1-[4-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]-3-propan-2-ylurea |
| SMILES | Cc1ccc([C@@](Cc2ccccc2)(NC(=O)NC(C)C)c2ccc(CI)cn2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3IN3O/c1-17(2)32-24(34)33-25(14-19-7-5-4-6-8-19,23-12-10-20(15-30)16-31-23)21-11-9-18(3)22(13-21)26(27,28)29/h4-13,16-17H,14-15H2,1-3H3,(H2,32,33,34)/t25-/m1/s1 |
| InChIKey | YIRJOBNGOPNODM-RUZDIDTESA-N |
| XLogP | 6.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.42 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|