C29H24F4IN3O — CID 89347603
1-(3-fluorophenyl)-3-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-1-[2-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea (PubChem CID 89347603) has the molecular formula C29H24F4IN3O and a molecular weight of 633.43 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-1-[2-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-1-[2-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 89347603 |
| Molecular Formula | C29H24F4IN3O |
| Molecular Weight | 633.43 g/mol |
| Exact Mass | 633.09 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[(1S)-1-[5-(iodomethyl)-2-pyridinyl]-1-[2-methyl-3-(trifluoromethyl)phenyl]-2-phenylethyl]urea |
| SMILES | Cc1c(C(F)(F)F)cccc1[C@](Cc1ccccc1)(NC(=O)Nc1cccc(F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C29H24F4IN3O/c1-19-24(11-6-12-25(19)29(31,32)33)28(16-20-7-3-2-4-8-20,26-14-13-21(17-34)18-35-26)37-27(38)36-23-10-5-9-22(30)15-23/h2-15,18H,16-17H2,1H3,(H2,36,37,38)/t28-/m0/s1 |
| InChIKey | JYYFZSVPRKXBTR-NDEPHWFRSA-N |
| XLogP | 7.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.43 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|