C16H16N2O5S — CID 89348821
(2S,3S)-2-(3-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)sulfonylaziridine (PubChem CID 89348821) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is (2S,3S)-2-(3-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)sulfonylaziridine.
| Compound Name | (2S,3S)-2-(3-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 89348821 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2S,3S)-2-(3-methoxyphenyl)-3-methyl-1-(4-nitrophenyl)sulfonylaziridine |
| SMILES | COc1cccc([C@H]2[C@H](C)N2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C16H16N2O5S/c1-11-16(12-4-3-5-14(10-12)23-2)17(11)24(21,22)15-8-6-13(7-9-15)18(19)20/h3-11,16H,1-2H3/t11-,16+,17?/m0/s1 |
| InChIKey | HJXNUPNTCSUHLI-QNQDRUDJSA-N |
| XLogP | 2.74 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|