C54H62O6 — CID 89349016
tert-butyl 2-[4-[[7-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]naphthalen-2-yl]-(4-hydroxy-2,3,5-trimethylphenyl)methyl]-2,3,6-trimethylphenoxy]acetate (PubChem CID 89349016) has the molecular formula C54H62O6 and a molecular weight of 807.08 g/mol. Its IUPAC name is tert-butyl 2-[4-[[7-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]naphthalen-2-yl]-(4-hydroxy-2,3,5-trimethylphenyl)methyl]-2,3,6-trimethylphenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[7-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]naphthalen-2-yl]-(4-hydroxy-2,3,5-trimethylphenyl)methyl]-2,3,6-trimethylphenoxy]acetate |
|---|---|
| PubChem CID | 89349016 |
| Molecular Formula | C54H62O6 |
| Molecular Weight | 807.08 g/mol |
| Exact Mass | 806.45 |
| IUPAC Name | tert-butyl 2-[4-[[7-[bis(4-hydroxy-2,3,5-trimethylphenyl)methyl]naphthalen-2-yl]-(4-hydroxy-2,3,5-trimethylphenyl)methyl]-2,3,6-trimethylphenoxy]acetate |
| SMILES | Cc1cc(C(c2ccc3ccc(C(c4cc(C)c(O)c(C)c4C)c4cc(C)c(OCC(=O)OC(C)(C)C)c(C)c4C)cc3c2)c2cc(C)c(O)c(C)c2C)c(C)c(C)c1O |
| InChI | InChI=1S/C54H62O6/c1-27-20-43(31(5)35(9)50(27)56)48(44-21-28(2)51(57)36(10)32(44)6)40-18-16-39-17-19-41(25-42(39)24-40)49(45-22-29(3)52(58)37(11)33(45)7)46-23-30(4)53(38(12)34(46)8)59-26-47(55)60-54(13,14)15/h16-25,48-49,56-58H,26H2,1-15H3 |
| InChIKey | KJKQAIMTOWHMLI-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.08 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|