C27H54S — CID 89351413
12,12,13,13-tetramethyl-6-(1-methylcyclooctyl)tetradecane-6-thiol (PubChem CID 89351413) has the molecular formula C27H54S and a molecular weight of 410.80 g/mol. Its IUPAC name is 12,12,13,13-tetramethyl-6-(1-methylcyclooctyl)tetradecane-6-thiol.
| Compound Name | 12,12,13,13-tetramethyl-6-(1-methylcyclooctyl)tetradecane-6-thiol |
|---|---|
| PubChem CID | 89351413 |
| Molecular Formula | C27H54S |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | 12,12,13,13-tetramethyl-6-(1-methylcyclooctyl)tetradecane-6-thiol |
| SMILES | CCCCCC(S)(CCCCCC(C)(C)C(C)(C)C)C1(C)CCCCCCC1 |
| InChI | InChI=1S/C27H54S/c1-8-9-14-22-27(28,26(7)20-16-11-10-12-17-21-26)23-18-13-15-19-25(5,6)24(2,3)4/h28H,8-23H2,1-7H3 |
| InChIKey | MALHGHANEWGYBF-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|