C28H42NO2P — CID 89356461
3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-yl-[2-(piperidin-1-ylmethyl)phenyl]phosphane (PubChem CID 89356461) has the molecular formula C28H42NO2P and a molecular weight of 455.62 g/mol. Its IUPAC name is 3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-yl-[2-(piperidin-1-ylmethyl)phenyl]phosphane.
| Compound Name | 3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-yl-[2-(piperidin-1-ylmethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 89356461 |
| Molecular Formula | C28H42NO2P |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.30 |
| IUPAC Name | 3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-yl-[2-(piperidin-1-ylmethyl)phenyl]phosphane |
| SMILES | CCCC(CC)(Pc1ccccc1CN1CCCCC1)c1cc(C)cc(C)c1OCOC |
| InChI | InChI=1S/C28H42NO2P/c1-6-15-28(7-2,25-19-22(3)18-23(4)27(25)31-21-30-5)32-26-14-10-9-13-24(26)20-29-16-11-8-12-17-29/h9-10,13-14,18-19,32H,6-8,11-12,15-17,20-21H2,1-5H3 |
| InChIKey | SAIUDDCTUTUPAE-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|