C16H17ClIN5O — CID 89359958
4-chloro-1-[[2-(iodomethyl)-4-methoxy-3,5-dimethylphenyl]methyl]pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 89359958) has the molecular formula C16H17ClIN5O and a molecular weight of 457.70 g/mol. Its IUPAC name is 4-chloro-1-[[2-(iodomethyl)-4-methoxy-3,5-dimethylphenyl]methyl]pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 4-chloro-1-[[2-(iodomethyl)-4-methoxy-3,5-dimethylphenyl]methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 89359958 |
| Molecular Formula | C16H17ClIN5O |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 4-chloro-1-[[2-(iodomethyl)-4-methoxy-3,5-dimethylphenyl]methyl]pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | COc1c(C)cc(Cn2ncc3c(Cl)nc(N)nc32)c(CI)c1C |
| InChI | InChI=1S/C16H17ClIN5O/c1-8-4-10(11(5-18)9(2)13(8)24-3)7-23-15-12(6-20-23)14(17)21-16(19)22-15/h4,6H,5,7H2,1-3H3,(H2,19,21,22) |
| InChIKey | YGGUKMNNUGXRRZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|