About neodymium(3+);carbonate;fluoride
neodymium(3+);carbonate;fluoride (PubChem CID 89370576) has the molecular formula CFNdO3
and a molecular weight of 223.25 g/mol. Its IUPAC name is neodymium(3+);carbonate;fluoride.
Molecular Properties
| Compound Name | neodymium(3+);carbonate;fluoride |
| PubChem CID | 89370576 |
| Molecular Formula | CFNdO3 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 220.89 |
| IUPAC Name | neodymium(3+);carbonate;fluoride |
| SMILES | O=C([O-])[O-].[F-].[Nd+3] |
| InChI | InChI=1S/CH2O3.FH.Nd/c2-1(3)4;;/h(H2,2,3,4);1H;/q;;+3/p-3 |
| InChIKey | QHMNAIOCQYKGHF-UHFFFAOYSA-K |
| XLogP | -5.44 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze neodymium(3+);carbonate;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium(3+);carbonate;fluoride?
The IUPAC name of neodymium(3+);carbonate;fluoride (CID 89370576) is neodymium(3+);carbonate;fluoride.
What is the SMILES notation for neodymium(3+);carbonate;fluoride?
The canonical SMILES for neodymium(3+);carbonate;fluoride is O=C([O-])[O-].[F-].[Nd+3].
What is the InChIKey of neodymium(3+);carbonate;fluoride?
The InChIKey is QHMNAIOCQYKGHF-UHFFFAOYSA-K. The full InChI is InChI=1S/CH2O3.FH.Nd/c2-1(3)4;;/h(H2,2,3,4);1H;/q;;+3/p-3.
What are the key properties of neodymium(3+);carbonate;fluoride?
neodymium(3+);carbonate;fluoride has a molecular weight of 223.25 g/mol, XLogP of -5.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium(3+);carbonate;fluoride is sourced from PubChem (CID 89370576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).