C12H22N2O3 — CID 89378021
(2R,4S)-4-amino-N-formyl-5,5-dimethyl-3-oxo-2-propan-2-ylhexanamide (PubChem CID 89378021) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (2R,4S)-4-amino-N-formyl-5,5-dimethyl-3-oxo-2-propan-2-ylhexanamide.
| Compound Name | (2R,4S)-4-amino-N-formyl-5,5-dimethyl-3-oxo-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 89378021 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (2R,4S)-4-amino-N-formyl-5,5-dimethyl-3-oxo-2-propan-2-ylhexanamide |
| SMILES | CC(C)[C@@H](C(=O)NC=O)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-7(2)8(11(17)14-6-15)9(16)10(13)12(3,4)5/h6-8,10H,13H2,1-5H3,(H,14,15,17)/t8-,10-/m1/s1 |
| InChIKey | MHSDAVQBMUUDFU-PSASIEDQSA-N |
| XLogP | 0.47 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|