C11H21NO4 — CID 121405668
(1-formyloxy-2-methylpropyl) (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 121405668) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is (1-formyloxy-2-methylpropyl) (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | (1-formyloxy-2-methylpropyl) (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 121405668 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | (1-formyloxy-2-methylpropyl) (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)C(OC=O)OC(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C11H21NO4/c1-7(2)10(15-6-13)16-9(14)8(12)11(3,4)5/h6-8,10H,12H2,1-5H3/t8-,10?/m1/s1 |
| InChIKey | VQSKWECJRPSYFU-HNHGDDPOSA-N |
| XLogP | 1.06 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|