C28H34N4O3S — CID 89380998
(Z,2R)-2-[(2-amino-2-methylpropanoyl)amino]-N-[(1R)-2-(1-benzothiophen-3-yl)-1-formamidoethyl]-4-(2-methylphenyl)hex-4-enamide (PubChem CID 89380998) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is (Z,2R)-2-[(2-amino-2-methylpropanoyl)amino]-N-[(1R)-2-(1-benzothiophen-3-yl)-1-formamidoethyl]-4-(2-methylphenyl)hex-4-enamide.
| Compound Name | (Z,2R)-2-[(2-amino-2-methylpropanoyl)amino]-N-[(1R)-2-(1-benzothiophen-3-yl)-1-formamidoethyl]-4-(2-methylphenyl)hex-4-enamide |
|---|---|
| PubChem CID | 89380998 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (Z,2R)-2-[(2-amino-2-methylpropanoyl)amino]-N-[(1R)-2-(1-benzothiophen-3-yl)-1-formamidoethyl]-4-(2-methylphenyl)hex-4-enamide |
| SMILES | C/C=C(/C[C@@H](NC(=O)C(C)(C)N)C(=O)N[C@H](Cc1csc2ccccc12)NC=O)c1ccccc1C |
| InChI | InChI=1S/C28H34N4O3S/c1-5-19(21-11-7-6-10-18(21)2)14-23(31-27(35)28(3,4)29)26(34)32-25(30-17-33)15-20-16-36-24-13-9-8-12-22(20)24/h5-13,16-17,23,25H,14-15,29H2,1-4H3,(H,30,33)(H,31,35)(H,32,34)/b19-5-/t23-,25-/m1/s1 |
| InChIKey | QSSSIJDLHUICIN-HFQLJPJVSA-N |
| XLogP | 3.66 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|