C26H28N2O2 — CID 89381018
(Z)-N-[(1R)-1-formamido-2-naphthalen-1-ylethyl]-4-(2-methylphenyl)hex-4-enamide (PubChem CID 89381018) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (Z)-N-[(1R)-1-formamido-2-naphthalen-1-ylethyl]-4-(2-methylphenyl)hex-4-enamide.
| Compound Name | (Z)-N-[(1R)-1-formamido-2-naphthalen-1-ylethyl]-4-(2-methylphenyl)hex-4-enamide |
|---|---|
| PubChem CID | 89381018 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (Z)-N-[(1R)-1-formamido-2-naphthalen-1-ylethyl]-4-(2-methylphenyl)hex-4-enamide |
| SMILES | C/C=C(/CCC(=O)N[C@H](Cc1cccc2ccccc12)NC=O)c1ccccc1C |
| InChI | InChI=1S/C26H28N2O2/c1-3-20(23-13-6-4-9-19(23)2)15-16-26(30)28-25(27-18-29)17-22-12-8-11-21-10-5-7-14-24(21)22/h3-14,18,25H,15-17H2,1-2H3,(H,27,29)(H,28,30)/b20-3-/t25-/m1/s1 |
| InChIKey | NGQYZNYYURMHFI-LXFRUGBFSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|