C36H52NO9P — CID 89390774
[(3R)-1-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-prop-2-enoxyphosphoryl]oxypropoxy]decan-3-yl] propanoate (PubChem CID 89390774) has the molecular formula C36H52NO9P and a molecular weight of 673.78 g/mol. Its IUPAC name is [(3R)-1-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-prop-2-enoxyphosphoryl]oxypropoxy]decan-3-yl] propanoate.
| Compound Name | [(3R)-1-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-prop-2-enoxyphosphoryl]oxypropoxy]decan-3-yl] propanoate |
|---|---|
| PubChem CID | 89390774 |
| Molecular Formula | C36H52NO9P |
| Molecular Weight | 673.78 g/mol |
| Exact Mass | 673.34 |
| IUPAC Name | [(3R)-1-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy-prop-2-enoxyphosphoryl]oxypropoxy]decan-3-yl] propanoate |
| SMILES | C=CCOP(=O)(OCCCOCC[C@@H](CCCCCCC)OC(=O)CC)OCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H52NO9P/c1-4-7-8-9-10-16-29(46-35(38)6-3)21-26-41-24-15-25-44-47(40,43-23-5-2)45-27-22-37-36(39)42-28-34-32-19-13-11-17-30(32)31-18-12-14-20-33(31)34/h5,11-14,17-20,29,34H,2,4,6-10,15-16,21-28H2,1,3H3,(H,37,39)/t29-,47?/m1/s1 |
| InChIKey | OALFRSCKPYYWNA-CVNCJCJLSA-N |
| XLogP | 8.35 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.78 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|