About CID 89392934
CID 89392934 (PubChem CID 89392934) has the molecular formula C9H7BFN3
and a molecular weight of 186.99 g/mol.
Molecular Properties
| Compound Name | CID 89392934 |
| PubChem CID | 89392934 |
| Molecular Formula | C9H7BFN3 |
| Molecular Weight | 186.99 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(F)c(Cn2cncn2)c1 |
| InChI | InChI=1S/C9H7BFN3/c10-8-1-2-9(11)7(3-8)4-14-6-12-5-13-14/h1-3,5-6H,4H2 |
| InChIKey | XDOZTOOQVXSAOW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.99 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89392934 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89392934?
The IUPAC name of CID 89392934 (CID 89392934) is not available.
What is the SMILES notation for CID 89392934?
The canonical SMILES for CID 89392934 is [B]c1ccc(F)c(Cn2cncn2)c1.
What is the InChIKey of CID 89392934?
The InChIKey is XDOZTOOQVXSAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BFN3/c10-8-1-2-9(11)7(3-8)4-14-6-12-5-13-14/h1-3,5-6H,4H2.
What are the key properties of CID 89392934?
CID 89392934 has a molecular weight of 186.99 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89392934 is sourced from PubChem (CID 89392934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).