C18H23NS — CID 89394768
2-(4-amino-3-cyclohexa-2,4-dien-1-ylcyclohex-3-en-1-yl)cyclohexa-1,3-diene-1-thiol (PubChem CID 89394768) has the molecular formula C18H23NS and a molecular weight of 285.46 g/mol. Its IUPAC name is 2-(4-amino-3-cyclohexa-2,4-dien-1-ylcyclohex-3-en-1-yl)cyclohexa-1,3-diene-1-thiol.
| Compound Name | 2-(4-amino-3-cyclohexa-2,4-dien-1-ylcyclohex-3-en-1-yl)cyclohexa-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 89394768 |
| Molecular Formula | C18H23NS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(4-amino-3-cyclohexa-2,4-dien-1-ylcyclohex-3-en-1-yl)cyclohexa-1,3-diene-1-thiol |
| SMILES | NC1=C(C2C=CC=CC2)CC(C2=C(S)CCC=C2)CC1 |
| InChI | InChI=1S/C18H23NS/c19-17-11-10-14(15-8-4-5-9-18(15)20)12-16(17)13-6-2-1-3-7-13/h1-4,6,8,13-14,20H,5,7,9-12,19H2 |
| InChIKey | FHYMTJTWGJROBD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|