C8H18N4O2 — CID 89420379
5-amino-2-[(2,2-dimethylhydrazinyl)methylideneamino]pentanoic acid (PubChem CID 89420379) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-amino-2-[(2,2-dimethylhydrazinyl)methylideneamino]pentanoic acid.
| Compound Name | 5-amino-2-[(2,2-dimethylhydrazinyl)methylideneamino]pentanoic acid |
|---|---|
| PubChem CID | 89420379 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 5-amino-2-[(2,2-dimethylhydrazinyl)methylideneamino]pentanoic acid |
| SMILES | CN(C)N/C=N/C(CCCN)C(=O)O |
| InChI | InChI=1S/C8H18N4O2/c1-12(2)11-6-10-7(8(13)14)4-3-5-9/h6-7H,3-5,9H2,1-2H3,(H,10,11)(H,13,14) |
| InChIKey | WENLUILGARUFEL-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|