C28H22F6N2O — CID 89440971
3-[2-methyl-3-[(1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl)oxymethyl]phenyl]-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 89440971) has the molecular formula C28H22F6N2O and a molecular weight of 516.49 g/mol. Its IUPAC name is 3-[2-methyl-3-[(1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl)oxymethyl]phenyl]-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-[2-methyl-3-[(1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl)oxymethyl]phenyl]-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 89440971 |
| Molecular Formula | C28H22F6N2O |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 3-[2-methyl-3-[(1-methyl-1,1a,6,6a-tetrahydrocyclopropa[a]inden-4-yl)oxymethyl]phenyl]-2,7-bis(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | Cc1c(COc2ccc3c(c2)CC2C(C)C32)cccc1-c1c(C(F)(F)F)nc2cc(C(F)(F)F)ccn12 |
| InChI | InChI=1S/C28H22F6N2O/c1-14-16(13-37-19-6-7-21-17(10-19)11-22-15(2)24(21)22)4-3-5-20(14)25-26(28(32,33)34)35-23-12-18(27(29,30)31)8-9-36(23)25/h3-10,12,15,22,24H,11,13H2,1-2H3 |
| InChIKey | ITNGHYQBHAXTNJ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |