C35H46F6N2O7 — CID 89453212
bis[2-methyl-1-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]propan-2-yl] carbonate (PubChem CID 89453212) has the molecular formula C35H46F6N2O7 and a molecular weight of 720.75 g/mol. Its IUPAC name is bis[2-methyl-1-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]propan-2-yl] carbonate.
| Compound Name | bis[2-methyl-1-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]propan-2-yl] carbonate |
|---|---|
| PubChem CID | 89453212 |
| Molecular Formula | C35H46F6N2O7 |
| Molecular Weight | 720.75 g/mol |
| Exact Mass | 720.32 |
| IUPAC Name | bis[2-methyl-1-[4-[4-(2,2,2-trifluoroethoxy)phenoxy]piperidin-1-yl]propan-2-yl] carbonate |
| SMILES | CC(C)(CN1CCC(Oc2ccc(OCC(F)(F)F)cc2)CC1)OC(=O)OC(C)(C)CN1CCC(Oc2ccc(OCC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C35H46F6N2O7/c1-32(2,21-42-17-13-29(14-18-42)47-27-9-5-25(6-10-27)45-23-34(36,37)38)49-31(44)50-33(3,4)22-43-19-15-30(16-20-43)48-28-11-7-26(8-12-28)46-24-35(39,40)41/h5-12,29-30H,13-24H2,1-4H3 |
| InChIKey | PFXXEHDFLPEFQZ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.75 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |