C29H48O3 — CID 89466184
ethyl (3E,7E,11E)-4,8,12,16-tetramethyl-2-(2-oxohexyl)heptadeca-3,7,11,15-tetraenoate (PubChem CID 89466184) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is ethyl (3E,7E,11E)-4,8,12,16-tetramethyl-2-(2-oxohexyl)heptadeca-3,7,11,15-tetraenoate.
| Compound Name | ethyl (3E,7E,11E)-4,8,12,16-tetramethyl-2-(2-oxohexyl)heptadeca-3,7,11,15-tetraenoate |
|---|---|
| PubChem CID | 89466184 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | ethyl (3E,7E,11E)-4,8,12,16-tetramethyl-2-(2-oxohexyl)heptadeca-3,7,11,15-tetraenoate |
| SMILES | CCCCC(=O)CC(/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)OCC |
| InChI | InChI=1S/C29H48O3/c1-8-10-20-28(30)22-27(29(31)32-9-2)21-26(7)19-13-18-25(6)17-12-16-24(5)15-11-14-23(3)4/h14,16,18,21,27H,8-13,15,17,19-20,22H2,1-7H3/b24-16+,25-18+,26-21+ |
| InChIKey | BPHIAJCPXUWHBB-BFCVGISDSA-N |
| XLogP | 8.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|