C19H30N2O12S2 — CID 89474142
[(2R,3R,4R)-4-butoxy-2-(2,4-dioxopyrimidin-1-yl)-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 89474142) has the molecular formula C19H30N2O12S2 and a molecular weight of 542.59 g/mol. Its IUPAC name is [(2R,3R,4R)-4-butoxy-2-(2,4-dioxopyrimidin-1-yl)-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4-butoxy-2-(2,4-dioxopyrimidin-1-yl)-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 89474142 |
| Molecular Formula | C19H30N2O12S2 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | [(2R,3R,4R)-4-butoxy-2-(2,4-dioxopyrimidin-1-yl)-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CCCCO[C@]1(C)[C@@H](OC(C)=O)[C@H](n2ccc(=O)[nH]c2=O)OC1(COS(C)(=O)=O)COS(C)(=O)=O |
| InChI | InChI=1S/C19H30N2O12S2/c1-6-7-10-29-18(3)15(32-13(2)22)16(21-9-8-14(23)20-17(21)24)33-19(18,11-30-34(4,25)26)12-31-35(5,27)28/h8-9,15-16H,6-7,10-12H2,1-5H3,(H,20,23,24)/t15-,16+,18+/m0/s1 |
| InChIKey | HWUIXKHICRIBLE-LZLYRXPVSA-N |
| XLogP | -0.74 |
| TPSA | 186.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|