C30H41Cl2NO3Si — CID 89481609
(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-4-hydroxybutan-2-yl]-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-2-one (PubChem CID 89481609) has the molecular formula C30H41Cl2NO3Si and a molecular weight of 562.65 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-4-hydroxybutan-2-yl]-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-4-hydroxybutan-2-yl]-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-2-one |
|---|---|
| PubChem CID | 89481609 |
| Molecular Formula | C30H41Cl2NO3Si |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-4-hydroxybutan-2-yl]-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-2-one |
| SMILES | C=CC[C@@]1(COCC[Si](C)(C)C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@@H](C)CCO)C1=O |
| InChI | InChI=1S/C30H41Cl2NO3Si/c1-6-15-30(21-36-17-18-37(3,4)5)20-27(24-8-7-9-26(32)19-24)28(23-10-12-25(31)13-11-23)33(29(30)35)22(2)14-16-34/h6-13,19,22,27-28,34H,1,14-18,20-21H2,2-5H3/t22-,27+,28+,30-/m0/s1 |
| InChIKey | ZWXICDNMDPSWIB-HOOXJESSSA-N |
| XLogP | 7.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|