C34H39Cl2NO4 — CID 58573529
(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-3-prop-2-enylpiperidin-2-one (PubChem CID 58573529) has the molecular formula C34H39Cl2NO4 and a molecular weight of 596.60 g/mol. Its IUPAC name is (3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 58573529 |
| Molecular Formula | C34H39Cl2NO4 |
| Molecular Weight | 596.60 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | (3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@]1(CCOCc2ccc(OC)cc2)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@@H](CC)CO)C1=O |
| InChI | InChI=1S/C34H39Cl2NO4/c1-4-17-34(18-19-41-23-24-9-15-30(40-3)16-10-24)21-31(26-7-6-8-28(36)20-26)32(25-11-13-27(35)14-12-25)37(33(34)39)29(5-2)22-38/h4,6-16,20,29,31-32,38H,1,5,17-19,21-23H2,2-3H3/t29-,31+,32+,34-/m0/s1 |
| InChIKey | NWVXMZXTARMWNM-OTLKBGDTSA-N |
| XLogP | 8.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.60 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|