C33H46Cl2N2O4SSi — CID 140573105
1-[(2S)-2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-oxo-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-1-yl]butyl]cyclopropane-1-sulfonamide (PubChem CID 140573105) has the molecular formula C33H46Cl2N2O4SSi and a molecular weight of 665.80 g/mol. Its IUPAC name is 1-[(2S)-2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-oxo-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-1-yl]butyl]cyclopropane-1-sulfonamide.
| Compound Name | 1-[(2S)-2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-oxo-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-1-yl]butyl]cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 140573105 |
| Molecular Formula | C33H46Cl2N2O4SSi |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 664.23 |
| IUPAC Name | 1-[(2S)-2-[(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-2-oxo-3-prop-2-enyl-3-(2-trimethylsilylethoxymethyl)piperidin-1-yl]butyl]cyclopropane-1-sulfonamide |
| SMILES | C=CC[C@@]1(COCC[Si](C)(C)C)C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@@H](CC)CC2(S(N)(=O)=O)CC2)C1=O |
| InChI | InChI=1S/C33H46Cl2N2O4SSi/c1-6-15-32(23-41-18-19-43(3,4)5)22-29(25-9-8-10-27(35)20-25)30(24-11-13-26(34)14-12-24)37(31(32)38)28(7-2)21-33(16-17-33)42(36,39)40/h6,8-14,20,28-30H,1,7,15-19,21-23H2,2-5H3,(H2,36,39,40)/t28-,29+,30+,32-/m0/s1 |
| InChIKey | ANJQEYJCJWIMDP-TWXNZYBRSA-N |
| XLogP | 7.96 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|