C28H39Cl2NOSi — CID 89482142
tert-butyl-[(1R,3S)-3-[3-(3-chlorophenyl)-2-(4-chlorophenyl)piperidin-1-yl]cyclopentyl]oxy-dimethylsilane (PubChem CID 89482142) has the molecular formula C28H39Cl2NOSi and a molecular weight of 504.62 g/mol. Its IUPAC name is tert-butyl-[(1R,3S)-3-[3-(3-chlorophenyl)-2-(4-chlorophenyl)piperidin-1-yl]cyclopentyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,3S)-3-[3-(3-chlorophenyl)-2-(4-chlorophenyl)piperidin-1-yl]cyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89482142 |
| Molecular Formula | C28H39Cl2NOSi |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | tert-butyl-[(1R,3S)-3-[3-(3-chlorophenyl)-2-(4-chlorophenyl)piperidin-1-yl]cyclopentyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@H](N2CCCC(c3cccc(Cl)c3)C2c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C28H39Cl2NOSi/c1-28(2,3)33(4,5)32-25-16-15-24(19-25)31-17-7-10-26(21-8-6-9-23(30)18-21)27(31)20-11-13-22(29)14-12-20/h6,8-9,11-14,18,24-27H,7,10,15-17,19H2,1-5H3/t24-,25+,26?,27?/m0/s1 |
| InChIKey | UCELCQTVAXDWBK-YCLMQULZSA-N |
| XLogP | 8.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|