C15H12F2N2OS — CID 89483576
3-(2-cyanopropan-2-yl)-2,4-difluoro-N-thiophen-2-ylbenzamide (PubChem CID 89483576) has the molecular formula C15H12F2N2OS and a molecular weight of 306.34 g/mol. Its IUPAC name is 3-(2-cyanopropan-2-yl)-2,4-difluoro-N-thiophen-2-ylbenzamide.
| Compound Name | 3-(2-cyanopropan-2-yl)-2,4-difluoro-N-thiophen-2-ylbenzamide |
|---|---|
| PubChem CID | 89483576 |
| Molecular Formula | C15H12F2N2OS |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-(2-cyanopropan-2-yl)-2,4-difluoro-N-thiophen-2-ylbenzamide |
| SMILES | CC(C)(C#N)c1c(F)ccc(C(=O)Nc2cccs2)c1F |
| InChI | InChI=1S/C15H12F2N2OS/c1-15(2,8-18)12-10(16)6-5-9(13(12)17)14(20)19-11-4-3-7-21-11/h3-7H,1-2H3,(H,19,20) |
| InChIKey | GECBIOBAZFRYCB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |