C23H21F2NO2S3 — CID 89485305
(5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[4-(6-ethoxy-2,3-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89485305) has the molecular formula C23H21F2NO2S3 and a molecular weight of 477.62 g/mol. Its IUPAC name is (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[4-(6-ethoxy-2,3-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[4-(6-ethoxy-2,3-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89485305 |
| Molecular Formula | C23H21F2NO2S3 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | (5Z)-3-(2-bicyclo[2.2.1]heptanyl)-5-[[4-(6-ethoxy-2,3-difluorophenyl)thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(F)c(F)c1-c1csc(/C=C2\SC(=S)N(C3CC4CCC3C4)C2=O)c1 |
| InChI | InChI=1S/C23H21F2NO2S3/c1-2-28-18-6-5-16(24)21(25)20(18)14-9-15(30-11-14)10-19-22(27)26(23(29)31-19)17-8-12-3-4-13(17)7-12/h5-6,9-13,17H,2-4,7-8H2,1H3/b19-10- |
| InChIKey | RTFLLGQZKWUADX-GRSHGNNSSA-N |
| XLogP | 6.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|