C12H12FNO6 — CID 89488231
2-[(2-fluoro-3,4-dimethoxyanilino)methylidene]propanedioic acid (PubChem CID 89488231) has the molecular formula C12H12FNO6 and a molecular weight of 285.23 g/mol. Its IUPAC name is 2-[(2-fluoro-3,4-dimethoxyanilino)methylidene]propanedioic acid.
| Compound Name | 2-[(2-fluoro-3,4-dimethoxyanilino)methylidene]propanedioic acid |
|---|---|
| PubChem CID | 89488231 |
| Molecular Formula | C12H12FNO6 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[(2-fluoro-3,4-dimethoxyanilino)methylidene]propanedioic acid |
| SMILES | COc1ccc(NC=C(C(=O)O)C(=O)O)c(F)c1OC |
| InChI | InChI=1S/C12H12FNO6/c1-19-8-4-3-7(9(13)10(8)20-2)14-5-6(11(15)16)12(17)18/h3-5,14H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | BDKTUSMJWMFNSS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|