C12H17NaO6S — CID 89496892
sodium;3-(2-carboxyethylsulfanyl)propanoic acid;(2E,4E)-hexa-2,4-dienoate (PubChem CID 89496892) has the molecular formula C12H17NaO6S and a molecular weight of 312.32 g/mol. Its IUPAC name is sodium;3-(2-carboxyethylsulfanyl)propanoic acid;(2E,4E)-hexa-2,4-dienoate.
| Compound Name | sodium;3-(2-carboxyethylsulfanyl)propanoic acid;(2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 89496892 |
| Molecular Formula | C12H17NaO6S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | sodium;3-(2-carboxyethylsulfanyl)propanoic acid;(2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)[O-].O=C(O)CCSCCC(=O)O.[Na+] |
| InChI | InChI=1S/C6H10O4S.C6H8O2.Na/c7-5(8)1-3-11-4-2-6(9)10;1-2-3-4-5-6(7)8;/h1-4H2,(H,7,8)(H,9,10);2-5H,1H3,(H,7,8);/q;;+1/p-1/b;3-2+,5-4+; |
| InChIKey | NRUWEZZMHCJSCR-DYQIYBMZSA-M |
| XLogP | -2.46 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|