C16H21N3O2S — CID 8961760
ethyl 2,4-dimethyl-5-[5-methyl-2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1H-pyrrole-3-carboxylate (PubChem CID 8961760) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[5-methyl-2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[5-methyl-2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 8961760 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[5-methyl-2-(prop-2-enylamino)-1,3-thiazol-4-yl]-1H-pyrrole-3-carboxylate |
| SMILES | C=CCNc1nc(-c2[nH]c(C)c(C(=O)OCC)c2C)c(C)s1 |
| InChI | InChI=1S/C16H21N3O2S/c1-6-8-17-16-19-14(11(5)22-16)13-9(3)12(10(4)18-13)15(20)21-7-2/h6,18H,1,7-8H2,2-5H3,(H,17,19) |
| InChIKey | YEUQEKXUIXBSSS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|