C18H13N3O4 — CID 8982625
[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate (PubChem CID 8982625) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 8982625 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate |
| SMILES | N#Cc1ccccc1NC(=O)COC(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C18H13N3O4/c19-10-12-5-1-3-7-14(12)20-17(22)11-24-18(23)9-15-13-6-2-4-8-16(13)25-21-15/h1-8H,9,11H2,(H,20,22) |
| InChIKey | PWSNPWKVTIXOJG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |