[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate

C18H13N3O4 — CID 8982625

IUPAC[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate
SMILESN#Cc1ccccc1NC(=O)COC(=O)Cc1noc2ccccc12
InChIInChI=1S/C18H13N3O4/c19-10-12-5-1-3-7-14(12)20-17(22)11-24-18(23)9-15-13-6-2-4-8-16(13)25-21-15/h1-8H,9,11H2,(H,20,22)
InChIKeyPWSNPWKVTIXOJG-UHFFFAOYSA-N
MW335.32 g/mol
LogP2.42
Rot. Bonds5

About [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate

[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate (PubChem CID 8982625) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate.

Molecular Properties

Compound Name[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate
PubChem CID8982625
Molecular FormulaC18H13N3O4
Molecular Weight335.32 g/mol
Exact Mass335.09
IUPAC Name[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate
SMILESN#Cc1ccccc1NC(=O)COC(=O)Cc1noc2ccccc12
InChIInChI=1S/C18H13N3O4/c19-10-12-5-1-3-7-14(12)20-17(22)11-24-18(23)9-15-13-6-2-4-8-16(13)25-21-15/h1-8H,9,11H2,(H,20,22)
InChIKeyPWSNPWKVTIXOJG-UHFFFAOYSA-N
XLogP2.42
TPSA105.22 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.32
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate?
The IUPAC name of [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate (CID 8982625) is [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate.
What is the SMILES notation for [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate?
The canonical SMILES for [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate is N#Cc1ccccc1NC(=O)COC(=O)Cc1noc2ccccc12.
What is the InChIKey of [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate?
The InChIKey is PWSNPWKVTIXOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O4/c19-10-12-5-1-3-7-14(12)20-17(22)11-24-18(23)9-15-13-6-2-4-8-16(13)25-21-15/h1-8H,9,11H2,(H,20,22).
What are the key properties of [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate?
[2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate has a molecular weight of 335.32 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-cyanoanilino)-2-oxoethyl] 2-(1,2-benzoxazol-3-yl)acetate is sourced from PubChem (CID 8982625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).