C19H20N6O3 — CID 8990419
methyl 2-[benzoyl-[2,5-dimethyl-3-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]amino]acetate (PubChem CID 8990419) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is methyl 2-[benzoyl-[2,5-dimethyl-3-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]amino]acetate.
| Compound Name | methyl 2-[benzoyl-[2,5-dimethyl-3-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]amino]acetate |
|---|---|
| PubChem CID | 8990419 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl 2-[benzoyl-[2,5-dimethyl-3-[(Z)-1,2,4-triazol-4-yliminomethyl]pyrrol-1-yl]amino]acetate |
| SMILES | COC(=O)CN(C(=O)c1ccccc1)n1c(C)cc(/C=N\n2cnnc2)c1C |
| InChI | InChI=1S/C19H20N6O3/c1-14-9-17(10-22-23-12-20-21-13-23)15(2)25(14)24(11-18(26)28-3)19(27)16-7-5-4-6-8-16/h4-10,12-13H,11H2,1-3H3/b22-10- |
| InChIKey | CGTYXRJKCYGXKJ-YVNNLAQVSA-N |
| XLogP | 1.53 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|