C27H35N3O3 — CID 90012300
benzyl 3-[[4-(1-tert-butylpiperidin-4-yl)phenyl]carbamoyl]azetidine-1-carboxylate (PubChem CID 90012300) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is benzyl 3-[[4-(1-tert-butylpiperidin-4-yl)phenyl]carbamoyl]azetidine-1-carboxylate.
| Compound Name | benzyl 3-[[4-(1-tert-butylpiperidin-4-yl)phenyl]carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 90012300 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | benzyl 3-[[4-(1-tert-butylpiperidin-4-yl)phenyl]carbamoyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)N1CCC(c2ccc(NC(=O)C3CN(C(=O)OCc4ccccc4)C3)cc2)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-27(2,3)30-15-13-22(14-16-30)21-9-11-24(12-10-21)28-25(31)23-17-29(18-23)26(32)33-19-20-7-5-4-6-8-20/h4-12,22-23H,13-19H2,1-3H3,(H,28,31) |
| InChIKey | OGVZFFZALOCVKP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |