C23H30BrFN2 — CID 90018782
N-benzyl-4-bromo-N-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]aniline (PubChem CID 90018782) has the molecular formula C23H30BrFN2 and a molecular weight of 433.41 g/mol. Its IUPAC name is N-benzyl-4-bromo-N-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]aniline.
| Compound Name | N-benzyl-4-bromo-N-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 90018782 |
| Molecular Formula | C23H30BrFN2 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-benzyl-4-bromo-N-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]aniline |
| SMILES | CC(C)(F)CN1CCC(CN(Cc2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C23H30BrFN2/c1-23(2,25)18-26-14-12-20(13-15-26)17-27(16-19-6-4-3-5-7-19)22-10-8-21(24)9-11-22/h3-11,20H,12-18H2,1-2H3 |
| InChIKey | AIVQYLKLDZHMKC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |