C20H20ClFN2O2S — CID 90022646
4-[(2-chloro-6-fluorophenyl)methyl]-2-(oxan-4-ylmethyl)-1,2,4-benzothiadiazin-3-one (PubChem CID 90022646) has the molecular formula C20H20ClFN2O2S and a molecular weight of 406.91 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-2-(oxan-4-ylmethyl)-1,2,4-benzothiadiazin-3-one.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-2-(oxan-4-ylmethyl)-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 90022646 |
| Molecular Formula | C20H20ClFN2O2S |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-2-(oxan-4-ylmethyl)-1,2,4-benzothiadiazin-3-one |
| SMILES | O=C1N(CC2CCOCC2)Sc2ccccc2N1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H20ClFN2O2S/c21-16-4-3-5-17(22)15(16)13-23-18-6-1-2-7-19(18)27-24(20(23)25)12-14-8-10-26-11-9-14/h1-7,14H,8-13H2 |
| InChIKey | VUBJOTPQKNCGFJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|