C20H12ClF3N2OS — CID 118046246
4-[(2-chloro-6-fluorophenyl)methyl]-2-(2,5-difluorophenyl)-1,2,4-benzothiadiazin-3-one (PubChem CID 118046246) has the molecular formula C20H12ClF3N2OS and a molecular weight of 420.84 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-2-(2,5-difluorophenyl)-1,2,4-benzothiadiazin-3-one.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-2-(2,5-difluorophenyl)-1,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 118046246 |
| Molecular Formula | C20H12ClF3N2OS |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-2-(2,5-difluorophenyl)-1,2,4-benzothiadiazin-3-one |
| SMILES | O=C1N(Cc2c(F)cccc2Cl)c2ccccc2SN1c1cc(F)ccc1F |
| InChI | InChI=1S/C20H12ClF3N2OS/c21-14-4-3-5-15(23)13(14)11-25-17-6-1-2-7-19(17)28-26(20(25)27)18-10-12(22)8-9-16(18)24/h1-10H,11H2 |
| InChIKey | YDMKQAGYDWNMMR-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|