C17H15NO4 — CID 90023678
(2S)-2-(9H-fluoren-1-ylamino)butanedioic acid (PubChem CID 90023678) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-1-ylamino)butanedioic acid.
| Compound Name | (2S)-2-(9H-fluoren-1-ylamino)butanedioic acid |
|---|---|
| PubChem CID | 90023678 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2S)-2-(9H-fluoren-1-ylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](Nc1cccc2c1Cc1ccccc1-2)C(=O)O |
| InChI | InChI=1S/C17H15NO4/c19-16(20)9-15(17(21)22)18-14-7-3-6-12-11-5-2-1-4-10(11)8-13(12)14/h1-7,15,18H,8-9H2,(H,19,20)(H,21,22)/t15-/m0/s1 |
| InChIKey | MCFYZANHYFEAHH-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |