C25H32FN2O11PS — CID 90047860
[(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-[[hydroxy(6-phenylmethoxycarbonylsulfanylhexoxy)phosphoryl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 90047860) has the molecular formula C25H32FN2O11PS and a molecular weight of 618.57 g/mol. Its IUPAC name is [(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-[[hydroxy(6-phenylmethoxycarbonylsulfanylhexoxy)phosphoryl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-[[hydroxy(6-phenylmethoxycarbonylsulfanylhexoxy)phosphoryl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 90047860 |
| Molecular Formula | C25H32FN2O11PS |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | [(2R,3R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-[[hydroxy(6-phenylmethoxycarbonylsulfanylhexoxy)phosphoryl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](n2cc(F)c(=O)[nH]c2=O)O[C@@H]1COP(=O)(O)OCCCCCCSC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H32FN2O11PS/c1-17(29)38-20-13-22(28-14-19(26)23(30)27-24(28)31)39-21(20)16-37-40(33,34)36-11-7-2-3-8-12-41-25(32)35-15-18-9-5-4-6-10-18/h4-6,9-10,14,20-22H,2-3,7-8,11-13,15-16H2,1H3,(H,33,34)(H,27,30,31)/t20-,21-,22-/m1/s1 |
| InChIKey | GTCIPKNGPRANQE-YPAWHYETSA-N |
| XLogP | 3.66 |
| TPSA | 172.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|