C26H27NO8 — CID 90048603
[(3R,4R)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl] 6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carboxylate (PubChem CID 90048603) has the molecular formula C26H27NO8 and a molecular weight of 481.50 g/mol. Its IUPAC name is [(3R,4R)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl] 6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carboxylate.
| Compound Name | [(3R,4R)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl] 6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90048603 |
| Molecular Formula | C26H27NO8 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | [(3R,4R)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl] 6-(6-prop-2-enoyloxyhexanoyloxy)naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCC(=O)Oc1ccc2cc(C(=O)O[C@H]3C(=O)N(C)C(=O)[C@@H]3C)ccc2c1 |
| InChI | InChI=1S/C26H27NO8/c1-4-21(28)33-13-7-5-6-8-22(29)34-20-12-11-17-14-19(10-9-18(17)15-20)26(32)35-23-16(2)24(30)27(3)25(23)31/h4,9-12,14-16,23H,1,5-8,13H2,2-3H3/t16-,23-/m1/s1 |
| InChIKey | BKEVHTLCDZSITR-WAIKUNEKSA-N |
| XLogP | 3.19 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|