C19H22N2 — CID 90051248
8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine (PubChem CID 90051248) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine.
| Compound Name | 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine |
|---|---|
| PubChem CID | 90051248 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine |
| SMILES | NN1C2=CCCC=C2C1C1=CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2/c20-21-18-9-5-4-8-17(18)19(21)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-3,6-9,12,15,19H,4-5,10-11,13,20H2 |
| InChIKey | GXPBGVNTJSTPQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|