About 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine
8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine (PubChem CID 90051248) has the molecular formula C19H22N2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine.
Molecular Properties
| Compound Name | 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine |
| PubChem CID | 90051248 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine |
| SMILES | NN1C2=CCCC=C2C1C1=CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H22N2/c20-21-18-9-5-4-8-17(18)19(21)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-3,6-9,12,15,19H,4-5,10-11,13,20H2 |
| InChIKey | GXPBGVNTJSTPQF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine?
The IUPAC name of 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine (CID 90051248) is 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine.
What is the SMILES notation for 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine?
The canonical SMILES for 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine is NN1C2=CCCC=C2C1C1=CCC(c2ccccc2)CC1.
What is the InChIKey of 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine?
The InChIKey is GXPBGVNTJSTPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2/c20-21-18-9-5-4-8-17(18)19(21)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-3,6-9,12,15,19H,4-5,10-11,13,20H2.
What are the key properties of 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine?
8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine has a molecular weight of 278.40 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-phenylcyclohexen-1-yl)-7-azabicyclo[4.2.0]octa-1,5-dien-7-amine is sourced from PubChem (CID 90051248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).