C53H100O6 — CID 90059052
(Z)-12-(7-carboxyheptyl)-11-heptyl-10,13-dioctyldocos-9-enedioic acid (PubChem CID 90059052) has the molecular formula C53H100O6 and a molecular weight of 833.38 g/mol. Its IUPAC name is (Z)-12-(7-carboxyheptyl)-11-heptyl-10,13-dioctyldocos-9-enedioic acid.
| Compound Name | (Z)-12-(7-carboxyheptyl)-11-heptyl-10,13-dioctyldocos-9-enedioic acid |
|---|---|
| PubChem CID | 90059052 |
| Molecular Formula | C53H100O6 |
| Molecular Weight | 833.38 g/mol |
| Exact Mass | 832.75 |
| IUPAC Name | (Z)-12-(7-carboxyheptyl)-11-heptyl-10,13-dioctyldocos-9-enedioic acid |
| SMILES | CCCCCCCC/C(=C/CCCCCCCC(=O)O)C(CCCCCCC)C(CCCCCCCC(=O)O)C(CCCCCCCC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C53H100O6/c1-4-7-10-13-21-29-38-47(40-31-23-15-17-26-35-44-51(54)55)49(42-33-20-12-9-6-3)50(43-34-25-19-28-37-46-53(58)59)48(39-30-22-14-11-8-5-2)41-32-24-16-18-27-36-45-52(56)57/h40,48-50H,4-39,41-46H2,1-3H3,(H,54,55)(H,56,57)(H,58,59)/b47-40- |
| InChIKey | DRTIKFKQJUUGMC-FFSDBIEMSA-N |
| XLogP | 17.46 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.38 |
| LogP ≤ 5 | 17.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|