C59H115NO8 — CID 158700029
(Z)-11-(7-carboxyheptyl)-12-heptyl-22-hydroxy-10,13-dioctyl-22-oxodocos-13-enoate;2-(2-hydroxyethoxy)ethyl-dimethylazanium (PubChem CID 158700029) has the molecular formula C59H115NO8 and a molecular weight of 966.57 g/mol. Its IUPAC name is (Z)-11-(7-carboxyheptyl)-12-heptyl-22-hydroxy-10,13-dioctyl-22-oxodocos-13-enoate;2-(2-hydroxyethoxy)ethyl-dimethylazanium.
| Compound Name | (Z)-11-(7-carboxyheptyl)-12-heptyl-22-hydroxy-10,13-dioctyl-22-oxodocos-13-enoate;2-(2-hydroxyethoxy)ethyl-dimethylazanium |
|---|---|
| PubChem CID | 158700029 |
| Molecular Formula | C59H115NO8 |
| Molecular Weight | 966.57 g/mol |
| Exact Mass | 965.86 |
| IUPAC Name | (Z)-11-(7-carboxyheptyl)-12-heptyl-22-hydroxy-10,13-dioctyl-22-oxodocos-13-enoate;2-(2-hydroxyethoxy)ethyl-dimethylazanium |
| SMILES | CCCCCCCC/C(=C/CCCCCCCC(=O)O)C(CCCCCCC)C(CCCCCCCC(=O)O)C(CCCCCCCC)CCCCCCCCC(=O)[O-].C[NH+](C)CCOCCO |
| InChI | InChI=1S/C53H100O6.C6H15NO2/c1-4-7-10-13-21-29-38-47(40-31-23-15-17-26-35-44-51(54)55)49(42-33-20-12-9-6-3)50(43-34-25-19-28-37-46-53(58)59)48(39-30-22-14-11-8-5-2)41-32-24-16-18-27-36-45-52(56)57;1-7(2)3-5-9-6-4-8/h40,48-50H,4-39,41-46H2,1-3H3,(H,54,55)(H,56,57)(H,58,59);8H,3-6H2,1-2H3/b47-40-; |
| InChIKey | IHKSXXGIBUBDKD-BNSUXGEGSA-N |
| XLogP | 14.26 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.57 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|