C21H23BrO4S2Si — CID 90060812
diethyl 2-bromo-5-(5-trimethylsilylthieno[3,2-b]thiophen-2-yl)benzene-1,4-dicarboxylate (PubChem CID 90060812) has the molecular formula C21H23BrO4S2Si and a molecular weight of 511.54 g/mol. Its IUPAC name is diethyl 2-bromo-5-(5-trimethylsilylthieno[3,2-b]thiophen-2-yl)benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2-bromo-5-(5-trimethylsilylthieno[3,2-b]thiophen-2-yl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 90060812 |
| Molecular Formula | C21H23BrO4S2Si |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | diethyl 2-bromo-5-(5-trimethylsilylthieno[3,2-b]thiophen-2-yl)benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2cc3sc([Si](C)(C)C)cc3s2)c(C(=O)OCC)cc1Br |
| InChI | InChI=1S/C21H23BrO4S2Si/c1-6-25-20(23)13-9-15(22)14(21(24)26-7-2)8-12(13)16-10-17-18(27-16)11-19(28-17)29(3,4)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | LYMAYARQJDRZPN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|