C20H24BrClFNO2Si — CID 90062085
2-bromo-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-chloro-4-fluorophenyl)-2-pyridinyl]ethanone (PubChem CID 90062085) has the molecular formula C20H24BrClFNO2Si and a molecular weight of 472.86 g/mol. Its IUPAC name is 2-bromo-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-chloro-4-fluorophenyl)-2-pyridinyl]ethanone.
| Compound Name | 2-bromo-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-chloro-4-fluorophenyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 90062085 |
| Molecular Formula | C20H24BrClFNO2Si |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 2-bromo-1-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3-chloro-4-fluorophenyl)-2-pyridinyl]ethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C(=O)CBr)nc(-c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C20H24BrClFNO2Si/c1-20(2,3)27(4,5)26-12-13-8-17(24-18(9-13)19(25)11-21)14-6-7-16(23)15(22)10-14/h6-10H,11-12H2,1-5H3 |
| InChIKey | ZHBWJNMDLIESSR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|