C13H20ClNO3Si — CID 141255252
5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloropyridine-2-carboxylic acid (PubChem CID 141255252) has the molecular formula C13H20ClNO3Si and a molecular weight of 301.85 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloropyridine-2-carboxylic acid.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 141255252 |
| Molecular Formula | C13H20ClNO3Si |
| Molecular Weight | 301.85 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloropyridine-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cnc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO3Si/c1-13(2,3)19(4,5)18-8-9-6-10(14)11(12(16)17)15-7-9/h6-7H,8H2,1-5H3,(H,16,17) |
| InChIKey | JZHMZCUPFDSUKG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|