C25H30ClN3O4Si — CID 90374214
(Z)-3-[5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-3-chloro-2-pyridinyl]-5-phenylpent-2-enoic acid (PubChem CID 90374214) has the molecular formula C25H30ClN3O4Si and a molecular weight of 500.07 g/mol. Its IUPAC name is (Z)-3-[5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-3-chloro-2-pyridinyl]-5-phenylpent-2-enoic acid.
| Compound Name | (Z)-3-[5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-3-chloro-2-pyridinyl]-5-phenylpent-2-enoic acid |
|---|---|
| PubChem CID | 90374214 |
| Molecular Formula | C25H30ClN3O4Si |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (Z)-3-[5-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-3-chloro-2-pyridinyl]-5-phenylpent-2-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nnc(-c2cnc(/C(=C\C(=O)O)CCc3ccccc3)c(Cl)c2)o1 |
| InChI | InChI=1S/C25H30ClN3O4Si/c1-25(2,3)34(4,5)32-16-21-28-29-24(33-21)19-13-20(26)23(27-15-19)18(14-22(30)31)12-11-17-9-7-6-8-10-17/h6-10,13-15H,11-12,16H2,1-5H3,(H,30,31)/b18-14- |
| InChIKey | ITTRKJWGOGHPKP-JXAWBTAJSA-N |
| XLogP | 6.41 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|