C15H19Cl2N3O3Si — CID 86732548
[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-(5,6-dichloro-3-pyridinyl)methanone (PubChem CID 86732548) has the molecular formula C15H19Cl2N3O3Si and a molecular weight of 388.33 g/mol. Its IUPAC name is [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-(5,6-dichloro-3-pyridinyl)methanone.
| Compound Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-(5,6-dichloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 86732548 |
| Molecular Formula | C15H19Cl2N3O3Si |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | [5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-(5,6-dichloro-3-pyridinyl)methanone |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nnc(C(=O)c2cnc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H19Cl2N3O3Si/c1-15(2,3)24(4,5)22-8-11-19-20-14(23-11)12(21)9-6-10(16)13(17)18-7-9/h6-7H,8H2,1-5H3 |
| InChIKey | IPNACODBDXBMDI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|