C26H31ClN2O4Si — CID 90374190
benzyl (E)-3-[4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-2-chlorophenyl]but-2-enoate (PubChem CID 90374190) has the molecular formula C26H31ClN2O4Si and a molecular weight of 499.08 g/mol. Its IUPAC name is benzyl (E)-3-[4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-2-chlorophenyl]but-2-enoate.
| Compound Name | benzyl (E)-3-[4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-2-chlorophenyl]but-2-enoate |
|---|---|
| PubChem CID | 90374190 |
| Molecular Formula | C26H31ClN2O4Si |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | benzyl (E)-3-[4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,3,4-oxadiazol-2-yl]-2-chlorophenyl]but-2-enoate |
| SMILES | C/C(=C\C(=O)OCc1ccccc1)c1ccc(-c2nnc(CO[Si](C)(C)C(C)(C)C)o2)cc1Cl |
| InChI | InChI=1S/C26H31ClN2O4Si/c1-18(14-24(30)31-16-19-10-8-7-9-11-19)21-13-12-20(15-22(21)27)25-29-28-23(33-25)17-32-34(5,6)26(2,3)4/h7-15H,16-17H2,1-6H3/b18-14+ |
| InChIKey | KBLBXSIYPMZPRV-NBVRZTHBSA-N |
| XLogP | 7.06 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|