C19H24ClFN2O3Si — CID 174106046
[4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]-5-chloro-2-fluorophenyl]carbamic acid (PubChem CID 174106046) has the molecular formula C19H24ClFN2O3Si and a molecular weight of 410.95 g/mol. Its IUPAC name is [4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]-5-chloro-2-fluorophenyl]carbamic acid.
| Compound Name | [4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]-5-chloro-2-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 174106046 |
| Molecular Formula | C19H24ClFN2O3Si |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [4-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]-5-chloro-2-fluorophenyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cncc(-c2cc(F)c(NC(=O)O)cc2Cl)c1 |
| InChI | InChI=1S/C19H24ClFN2O3Si/c1-19(2,3)27(4,5)26-11-12-6-13(10-22-9-12)14-7-16(21)17(8-15(14)20)23-18(24)25/h6-10,23H,11H2,1-5H3,(H,24,25) |
| InChIKey | JWUXRIPEGRFLKW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|