C20H19IN6O3S — CID 90072756
3-[6-amino-8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropanamide (PubChem CID 90072756) has the molecular formula C20H19IN6O3S and a molecular weight of 550.38 g/mol. Its IUPAC name is 3-[6-amino-8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropanamide.
| Compound Name | 3-[6-amino-8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 90072756 |
| Molecular Formula | C20H19IN6O3S |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | 3-[6-amino-8-[[2-(2-iodophenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropanamide |
| SMILES | Nc1ncnc2c1nc(SC1=COC(c3ccccc3I)O1)n2CCC(=O)NC1CC1 |
| InChI | InChI=1S/C20H19IN6O3S/c21-13-4-2-1-3-12(13)19-29-9-15(30-19)31-20-26-16-17(22)23-10-24-18(16)27(20)8-7-14(28)25-11-5-6-11/h1-4,9-11,19H,5-8H2,(H,25,28)(H2,22,23,24) |
| InChIKey | TZXCWZCYLRNWCJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|